9-chloro-7-(2-chlorophenyl)-3,5-dihydro-1H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-2-one structure
|
Common Name | 9-chloro-7-(2-chlorophenyl)-3,5-dihydro-1H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-2-one | ||
|---|---|---|---|---|
| CAS Number | 49614-12-2 | Molecular Weight | 359.20900 | |
| Density | 1.542g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H12Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-chloro-7-(2-chlorophenyl)-3,5-dihydro-1H-[1,2,4]triazino[4,3-a][1,4]benzodiazepin-2-one |
|---|
| Density | 1.542g/cm3 |
|---|---|
| Molecular Formula | C17H12Cl2N4O |
| Molecular Weight | 359.20900 |
| Exact Mass | 358.03900 |
| PSA | 60.55000 |
| LogP | 2.30620 |
| Index of Refraction | 1.739 |
| InChIKey | FDUKWPWJJAHWEU-UHFFFAOYSA-N |
| SMILES | O=C1CN2C(=NN1)CN=C(c1ccccc1Cl)c1cc(Cl)ccc12 |
|
~%
9-chloro-7-(2-c... CAS#:49614-12-2 |
| Literature: The Upjohn Company Patent: US3933816 A1, 1976 ; |