chavicine
Modify Date: 2025-08-29 11:35:50
chavicine structure
|
Common Name | chavicine | ||
|---|---|---|---|---|
| CAS Number | 495-91-0 | Molecular Weight | 285.33800 | |
| Density | 1.211g/cm3 | Boiling Point | 498.5ºC at 760 mmHg | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.3ºC | |
| Name | (2Z,4Z)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 498.5ºC at 760 mmHg |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.33800 |
| Flash Point | 255.3ºC |
| Exact Mass | 285.13600 |
| PSA | 38.77000 |
| LogP | 2.93510 |
| Vapour Pressure | 4.5E-10mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | MXXWOMGUGJBKIW-PORYWJCVSA-N |
| SMILES | O=C(C=CC=Cc1ccc2c(c1)OCO2)N1CCCCC1 |
|
~%
chavicine CAS#:495-91-0 |
| Literature: Soumyanath, Amala; Venkatasamy, Radhakrishnan; Joshi, Meghna; Faas, Laura; Adejuyigbe, Bimpe; Drake, Alex F.; Hider, Robert C.; Young, Antony R. Photochemistry and Photobiology, 2006 , vol. 82, # 6 p. 1541 - 1548 |
|
~%
chavicine CAS#:495-91-0 |
| Literature: Kozukue, Nobuyuki; Park, Mal-Sun; Choi, Suk-Hyun; Lee, Seung-Un; Ohnishi-Kameyama, Mayumi; Levin, Carol E.; Friedman, Mendel Journal of Agricultural and Food Chemistry, 2007 , vol. 55, # 17 p. 7131 - 7139 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| cis-cis-Piperin |
| 1-cis,cis-Piperinoyl-piperidin |
| 1-cis,cis-piperinoyl-piperidine |
| Chavicine |