2-bis(methylsulfanyl)phosphorylsulfanylethyl-diethyl-methylazanium,bromide
Modify Date: 2025-10-06 18:35:49
2-bis(methylsulfanyl)phosphorylsulfanylethyl-diethyl-methylazanium,bromide structure
|
Common Name | 2-bis(methylsulfanyl)phosphorylsulfanylethyl-diethyl-methylazanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 4936-67-8 | Molecular Weight | 368.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H23BrNOPS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bis(methylsulfanyl)phosphorylsulfanylethyl-diethyl-methylazanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H23BrNOPS3 |
|---|---|
| Molecular Weight | 368.35800 |
| Exact Mass | 366.98600 |
| PSA | 102.78000 |
| LogP | 1.04410 |
| InChIKey | YQDPRZDBJACJKK-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(CC)CCSP(=O)(SC)SC.[Br-] |
| 2-bis(methylsulfanyl)phosphorylsulfanylethyl-diethyl-methylazanium bromide |
| Ammonium,diethyl(2-mercaptoethyl)methyl-,bromide,S-ester with S,S-dimethylphosphorotrithioate |
| Ethanaminium,2-((bis(methylthio)phosphinyl)thio)-N,N-diethyl-N-methyl-,bromide |
| HC 8209 |
| Diethyl(2-mercaptoethyl)methylammonium bromide S-ester with S,S-dimethyl phosphorotrithioate |
| Ethanaminium,2-((bis(methylthio)phosphinyl)thio)-N,N-diethyl-N-methyl-,bromide (9CI) |