1-(3,3-difluoro-2-iodocyclopropen-1-yl)-4-methoxybenzene structure
|
Common Name | 1-(3,3-difluoro-2-iodocyclopropen-1-yl)-4-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 491593-73-8 | Molecular Weight | 308.06300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7F2IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,3-difluoro-2-iodocyclopropen-1-yl)-4-methoxybenzene |
|---|
| Molecular Formula | C10H7F2IO |
|---|---|
| Molecular Weight | 308.06300 |
| Exact Mass | 307.95100 |
| PSA | 9.23000 |
| LogP | 3.49020 |
| InChIKey | SJLZSMQUSNGFDQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=C(I)C2(F)F)cc1 |
|
~72%
1-(3,3-difluoro... CAS#:491593-73-8 |
| Literature: Xu, Wei; Chen, Qing-Yun Journal of Organic Chemistry, 2002 , vol. 67, # 26 p. 9421 - 9427 |
|
~%
1-(3,3-difluoro... CAS#:491593-73-8 |
| Literature: Xu, Wei; Chen, Qing-Yun Journal of Organic Chemistry, 2002 , vol. 67, # 26 p. 9421 - 9427 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |