(4-aminophenyl)-(4-chlorophenyl)methanone structure
|
Common Name | (4-aminophenyl)-(4-chlorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 4913-77-3 | Molecular Weight | 231.67800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-aminophenyl)-(4-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10ClNO |
|---|---|
| Molecular Weight | 231.67800 |
| Exact Mass | 231.04500 |
| PSA | 43.09000 |
| LogP | 3.73440 |
| InChIKey | BBUQOIDPQZFKKY-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2922399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-AMINO-4'-CHLOROBENZOPHENONE |
| 4-Amino-4'-chlor-benzophenon |