[5-(carbamoylhydrazinylidene)hexan-2-ylideneamino]urea
Modify Date: 2025-09-29 19:22:47
![[5-(carbamoylhydrazinylidene)hexan-2-ylideneamino]urea Structure](https://image.chemsrc.com/caspic/388/4904-47-6.png)
[5-(carbamoylhydrazinylidene)hexan-2-ylideneamino]urea structure
|
Common Name | [5-(carbamoylhydrazinylidene)hexan-2-ylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 4904-47-6 | Molecular Weight | 228.25200 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H16N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(E)-[(5Z)-5-(carbamoylhydrazinylidene)hexan-2-ylidene]amino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C8H16N6O2 |
| Molecular Weight | 228.25200 |
| Exact Mass | 228.13300 |
| PSA | 134.96000 |
| LogP | 2.03740 |
| Index of Refraction | 1.596 |
| InChIKey | SRZBDYPXDAMGRV-JTAXDKCCSA-N |
| SMILES | CC(CCC(C)=NNC(N)=O)=NNC(N)=O |
|
~%
[5-(carbamoylhy... CAS#:4904-47-6 |
| Literature: Posner Chemische Berichte, 1901 , vol. 34, p. 3985 |
|
~%
[5-(carbamoylhy... CAS#:4904-47-6 |
| Literature: Davison; Christie Journal of the Chemical Society, 1955 , p. 3389 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hexan-2,5-dion-disemicarbazon |
| hexane-2,5-dione disemicarbazone |
| Acetonylaceton-bis-semicarbazon |
| Acetonylaceton-disemicarbazon |
| Acetylglaceton-bis-semicarbazon |