Gaultherin structure
|
Common Name | Gaultherin | ||
|---|---|---|---|---|
| CAS Number | 490-67-5 | Molecular Weight | 446.402 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 709.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H26O12 | Melting Point | 249.2ºC | |
| MSDS | N/A | Flash Point | 249.2±26.4 °C | |
Use of GaultherinGaultherin, a natural salicylate derivative, is isolated from Gaultheria yunnanensis. Gaultherin is a non-steroidal anti-inflammatory drug (NSAID). Gaultherin has analgesic and anti-inflammatory effects and lack gastric ulcerogenic effect compared to Aspirin[1]. |
| Name | methyl 2-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxan-2-yl]oxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Gaultherin, a natural salicylate derivative, is isolated from Gaultheria yunnanensis. Gaultherin is a non-steroidal anti-inflammatory drug (NSAID). Gaultherin has analgesic and anti-inflammatory effects and lack gastric ulcerogenic effect compared to Aspirin[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 709.0±60.0 °C at 760 mmHg |
| Melting Point | 249.2ºC |
| Molecular Formula | C19H26O12 |
| Molecular Weight | 446.402 |
| Flash Point | 249.2±26.4 °C |
| Exact Mass | 446.142426 |
| PSA | 184.60000 |
| LogP | 0.25 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | VHUNCYDAXJGCLO-AHMNSWSSSA-N |
| SMILES | COC(=O)c1ccccc1OC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O |
| Methyl Salicylate-2-primeveroside |
| MONOTROPITOSIDE |
| Methyl Salicylate-2-glucoxyloside |
| 2-[(6-O-b-D-Xylopyranosyl-b-D-glucopyranosyl)oxy]benzoic Acid Methyl Ester |
| methyl 2-[(6-o-pentopyranosylhexopyranosyl)oxy]benzoate |
| Gaultherin |
| Methyl 2-{[6-O-(β-D-xylopyranosyl)-β-D-glucopyranosyl]oxy}benzoate |
| Monotropitin |
| Benzoic acid, 2-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-, methyl ester |
| methyl 2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-[[(2R,3S,4R,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxybenzoate |