methyl 2-but-3-enyl-2-prop-2-enylpyrrolidine-1-carboxylate
Modify Date: 2025-08-25 20:03:15
methyl 2-but-3-enyl-2-prop-2-enylpyrrolidine-1-carboxylate structure
|
Common Name | methyl 2-but-3-enyl-2-prop-2-enylpyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 489475-37-8 | Molecular Weight | 223.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-but-3-enyl-2-prop-2-enylpyrrolidine-1-carboxylate |
|---|
| Molecular Formula | C13H21NO2 |
|---|---|
| Molecular Weight | 223.31100 |
| Exact Mass | 223.15700 |
| PSA | 29.54000 |
| LogP | 3.06760 |
| InChIKey | ACHWBTLIXJNVGA-UHFFFAOYSA-N |
| SMILES | C=CCCC1(CC=C)CCCN1C(=O)OC |
|
~69%
methyl 2-but-3-... CAS#:489475-37-8 |
| Literature: Suga, Seiji; Watanabe, Mitsuru; Yoshida, Jun-ichi Journal of the American Chemical Society, 2002 , vol. 124, # 50 p. 14824 - 14825 |
|
~%
methyl 2-but-3-... CAS#:489475-37-8 |
| Literature: Suga, Seiji; Watanabe, Mitsuru; Yoshida, Jun-ichi Journal of the American Chemical Society, 2002 , vol. 124, # 50 p. 14824 - 14825 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |