1-(2-amino-5-(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone structure
|
Common Name | 1-(2-amino-5-(trifluoromethyl)phenyl)-2,2,2-trifluoroethanone | ||
|---|---|---|---|---|
| CAS Number | 489429-73-4 | Molecular Weight | 257.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-Amino-5-(trifluoromethyl)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5F6NO |
|---|---|
| Molecular Weight | 257.13300 |
| Exact Mass | 257.02800 |
| PSA | 43.09000 |
| LogP | 3.61380 |
| InChIKey | GKGJOBCKNGVLON-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(=O)C(F)(F)F |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD18071074 |