5-chloro-1-[3-(trifluoromethyl)phenyl]pentan-1-one structure
|
Common Name | 5-chloro-1-[3-(trifluoromethyl)phenyl]pentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 487058-80-0 | Molecular Weight | 264.67100 | |
| Density | 1.229g/cm3 | Boiling Point | 299.856ºC at 760 mmHg | |
| Molecular Formula | C12H12ClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.148ºC | |
| Name | 5-chloro-1-[3-(trifluoromethyl)phenyl]pentan-1-one |
|---|
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 299.856ºC at 760 mmHg |
| Molecular Formula | C12H12ClF3O |
| Molecular Weight | 264.67100 |
| Flash Point | 135.148ºC |
| Exact Mass | 264.05300 |
| PSA | 17.07000 |
| LogP | 4.29720 |
| Index of Refraction | 1.469 |
| InChIKey | PNOPDBDSEXJMEE-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCl)c1cccc(C(F)(F)F)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |