[2-[(6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl]-4-nitrophenyl] carbonate
Modify Date: 2025-08-26 10:45:20
![[2-[(6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl]-4-nitrophenyl] carbonate Structure](https://image.chemsrc.com/caspic/444/485318-64-7.png)
[2-[(6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl]-4-nitrophenyl] carbonate structure
|
Common Name | [2-[(6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl]-4-nitrophenyl] carbonate | ||
|---|---|---|---|---|
| CAS Number | 485318-64-7 | Molecular Weight | 435.15900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H9BrNO8- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-[(6-bromo-7-hydroxy-2-oxochromen-4-yl)methyl]-4-nitrophenyl] carbonate |
|---|
| Molecular Formula | C17H9BrNO8- |
|---|---|
| Molecular Weight | 435.15900 |
| Exact Mass | 433.95100 |
| PSA | 145.62000 |
| LogP | 4.77830 |
| InChIKey | VKHQKNUADOJGKI-UHFFFAOYSA-M |
| SMILES | O=C([O-])Oc1ccc([N+](=O)[O-])cc1Cc1cc(=O)oc2cc(O)c(Br)cc12 |
|
~%
[2-[(6-bromo-7-... CAS#:485318-64-7 |
| Literature: Montgomery, Heather J; Perdicakis, Basil; Fishlock, Dan; Lajoie, Gilles A; Jervis, Eric; Guy Guillemette Bioorganic and medicinal chemistry, 2002 , vol. 10, # 6 p. 1919 - 1927 |
|
~%
[2-[(6-bromo-7-... CAS#:485318-64-7 |
| Literature: Montgomery, Heather J; Perdicakis, Basil; Fishlock, Dan; Lajoie, Gilles A; Jervis, Eric; Guy Guillemette Bioorganic and medicinal chemistry, 2002 , vol. 10, # 6 p. 1919 - 1927 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |