hydroxy-[4-[4-[hydroxy(dimethyl)silyl]phenyl]phenyl]-dimethylsilane
Modify Date: 2025-08-27 11:50:21
![hydroxy-[4-[4-[hydroxy(dimethyl)silyl]phenyl]phenyl]-dimethylsilane Structure](https://image.chemsrc.com/caspic/362/4852-15-7.png)
hydroxy-[4-[4-[hydroxy(dimethyl)silyl]phenyl]phenyl]-dimethylsilane structure
|
Common Name | hydroxy-[4-[4-[hydroxy(dimethyl)silyl]phenyl]phenyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 4852-15-7 | Molecular Weight | 302.51600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | hydroxy-[4-[4-[hydroxy(dimethyl)silyl]phenyl]phenyl]-dimethylsilane |
|---|
| Molecular Formula | C16H22O2Si2 |
|---|---|
| Molecular Weight | 302.51600 |
| Exact Mass | 302.11600 |
| PSA | 40.46000 |
| LogP | 2.16240 |
| InChIKey | DITWCTLKOLJYFI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(O)c1ccc(-c2ccc([Si](C)(C)O)cc2)cc1 |
|
~0%
Detail
|
| Literature: Everson, Daniel A.; Jones, Brittany A.; Weix, Daniel J. Journal of the American Chemical Society, 2012 , vol. 134, # 14 p. 6146 - 6159 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |