1,4-bis[[4-(1,1-dimethylethyl)phenyl]amino]-5,8-dihydroxyanthraquinone structure
|
Common Name | 1,4-bis[[4-(1,1-dimethylethyl)phenyl]amino]-5,8-dihydroxyanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 4851-50-7 | Molecular Weight | 534.64500 | |
| Density | 1.268 g/cm3 | Boiling Point | 695.7ºC at 760 mmHg | |
| Molecular Formula | C34H34N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 374.6ºC | |
| Name | 1,4-bis(4-tert-butylanilino)-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268 g/cm3 |
|---|---|
| Boiling Point | 695.7ºC at 760 mmHg |
| Molecular Formula | C34H34N2O4 |
| Molecular Weight | 534.64500 |
| Flash Point | 374.6ºC |
| Exact Mass | 534.25200 |
| PSA | 98.66000 |
| LogP | 8.10140 |
| Index of Refraction | 1.672 |
| InChIKey | KWBCXNHXXWZCMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(Nc3ccc(C(C)(C)C)cc3)c3c2C(=O)c2c(O)ccc(O)c2C3=O)cc1 |
|
~%
1,4-bis[[4-(1,1... CAS#:4851-50-7 |
| Literature: Iwanaga, Hiroki; Naito, Katsuyuki; Nakai, Yutaka Molecular Crystals and Liquid Crystals Science and Technology Section A: Molecular Crystals and Liquid Crystals, 2001 , vol. 364, p. 211 - 218 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 225-443-9 |
| Solvaperm Green G |