Lecanoricacid structure
|
Common Name | Lecanoricacid | ||
|---|---|---|---|---|
| CAS Number | 480-56-8 | Molecular Weight | 318.278 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 557.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O7 | Melting Point | 175-176ºC | |
| MSDS | N/A | Flash Point | 208.3±23.6 °C | |
Use of LecanoricacidLecanoric acid is a histidine-decarboxylase inhibitor isolated from fungus. The inhibition by lecanoric acid is competitive with histidineand noncompetitive with pyridoxal phosphate. Lecanoric acid did not inhibit aromatic amino acid decarboxylase[1]. |
| Name | o-orsellinate depside |
|---|---|
| Synonym | More Synonyms |
| Description | Lecanoric acid is a histidine-decarboxylase inhibitor isolated from fungus. The inhibition by lecanoric acid is competitive with histidineand noncompetitive with pyridoxal phosphate. Lecanoric acid did not inhibit aromatic amino acid decarboxylase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 557.1±50.0 °C at 760 mmHg |
| Melting Point | 175-176ºC |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.278 |
| Flash Point | 208.3±23.6 °C |
| Exact Mass | 318.073944 |
| PSA | 124.29000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | HEMSJKZDHNSSEW-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(=O)c2c(C)cc(O)cc2O)cc(O)c1C(=O)O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| Benzoic acid, 4-[(2,4-dihydroxy-6-methylbenzoyl)oxy]-2-hydroxy-6-methyl- |
| 4-[(2,4-Dihydroxy-6-methylbenzoyl)oxy]-2-hydroxy-6-methylbenzoic acid |
| 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-hydroxy-6-methylbenzoic acid |
| o-orsellinate depside |
| lecanoric aicd |
| Lecanoric acid |
| lecanolic acid |
| 2,4-Dihydroxy-6-methylbenzoic acid 4-carboxy-3-hydroxy-5-methylphenyl ester |
| Lecanoricacid |
| Lecanorsaeure |