4-(2-Chloroethyl)benzenesulfonyl chloride
Modify Date: 2025-09-17 20:03:34
4-(2-Chloroethyl)benzenesulfonyl chloride structure
|
Common Name | 4-(2-Chloroethyl)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 4796-23-0 | Molecular Weight | 239.11900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Cl2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-Chloroethyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8Cl2O2S |
|---|---|
| Molecular Weight | 239.11900 |
| Exact Mass | 237.96200 |
| PSA | 42.52000 |
| LogP | 3.47620 |
| InChIKey | ZYIVPEJFZXDHRR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(CCCl)cc1 |
| HS Code | 2904909090 |
|---|
|
~%
4-(2-Chloroethy... CAS#:4796-23-0 |
| Literature: Hayman,D.F. et al. Journal of Pharmacy and Pharmacology, 1964 , vol. 16, p. 538 - 548 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-(2-CHLORO-ETHYL)-BENZENESULFONYL CHLORIDE |
| p-(2-Chlorethyl)benzolsulfonsaeurechlorid |
| p-(2-Chlorethyl)benzolsulfonylchlorid |
| 4-(2-chloroethyl)benzene-1-sulfonyl chloride |