5,6-dihydroxyindole-2-carboxylic acid structure
|
Common Name | 5,6-dihydroxyindole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 4790-08-3 | Molecular Weight | 193.15600 | |
| Density | 1.736g/cm3 | Boiling Point | 578.6ºC at 760mmHg | |
| Molecular Formula | C9H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.8ºC | |
| Name | 5,6-dihydroxyindole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.736g/cm3 |
|---|---|
| Boiling Point | 578.6ºC at 760mmHg |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.15600 |
| Flash Point | 303.8ºC |
| Exact Mass | 193.03800 |
| PSA | 93.55000 |
| LogP | 1.27730 |
| Index of Refraction | 1.838 |
| InChIKey | YFTGOBNOJKXZJC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cc(O)c(O)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,6-Dihydroxy-1H-indole-2-carboxylic acid |
| 5,6-Dihydroxyindole-2-carboxylic Acid |