IK-862 structure
|
Common Name | IK-862 | ||
|---|---|---|---|---|
| CAS Number | 478911-60-3 | Molecular Weight | 433.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H27N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IK-862IK-862 is a selective inhibitor of TACE (ADAM17). |
| Name | IK-862 |
|---|
| Description | IK-862 is a selective inhibitor of TACE (ADAM17). |
|---|---|
| References | 1. Georgiadis D, Yiotakis A. (2008) Specific targeting of metzincin family members with small-molecule inhibitors: progress toward a multifarious challenge. Bioorg. Med. Chem., 16 (19): 8781-94. [PMID:18790648] |
| Molecular Formula | C25H27N3O4 |
|---|---|
| Molecular Weight | 433.5 |
| InChIKey | YDMIPBHQKFOFQW-NSYGIPOTSA-N |
| SMILES | Cc1cc(COc2ccc(C3(C)CCN(C(C)C(=O)NO)C3=O)cc2)c2ccccc2n1 |