Benzoic acid,4-[(3-oxobutyl)amino]-, ethyl ester structure
|
Common Name | Benzoic acid,4-[(3-oxobutyl)amino]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 4788-79-8 | Molecular Weight | 235.27900 | |
| Density | 1.12g/cm3 | Boiling Point | 396.1ºC at 760 mmHg | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | Piperazine,1-(4-butylphenyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 396.1ºC at 760 mmHg |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.27900 |
| Flash Point | 193.4ºC |
| Exact Mass | 235.12100 |
| PSA | 55.40000 |
| LogP | 2.32730 |
| Index of Refraction | 1.543 |
| InChIKey | NSNWTQNUVXLMQX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NCCC(C)=O)cc1 |
|
~%
Benzoic acid,4-... CAS#:4788-79-8 |
| Literature: Singer, Robert D.; Vaughan, Keith; Hooper, Donald L. Canadian Journal of Chemistry, 1986 , vol. 64, p. 1567 - 1572 |
|
~%
Benzoic acid,4-... CAS#:4788-79-8 |
| Literature: Singer, Robert D.; Vaughan, Keith; Hooper, Donald L. Canadian Journal of Chemistry, 1986 , vol. 64, p. 1567 - 1572 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(p-Carbethoxyphenyl)amino-2-butanon |
| 4-(4-Carbethoxy-phenylamino)-2-butanon |
| 4-(4-butyl-phenyl)-piperazine |