2-[(methoxy-phenyl-phosphoryl)methyl]isoindole-1,3-dione
Modify Date: 2025-09-04 20:16:44
![2-[(methoxy-phenyl-phosphoryl)methyl]isoindole-1,3-dione Structure](https://image.chemsrc.com/caspic/307/4771-84-0.png)
2-[(methoxy-phenyl-phosphoryl)methyl]isoindole-1,3-dione structure
|
Common Name | 2-[(methoxy-phenyl-phosphoryl)methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 4771-84-0 | Molecular Weight | 315.26000 | |
| Density | 1.37g/cm3 | Boiling Point | 457.9ºC at 760 mmHg | |
| Molecular Formula | C16H14NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.7ºC | |
| Name | 2-[[methoxy(phenyl)phosphoryl]methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 457.9ºC at 760 mmHg |
| Molecular Formula | C16H14NO4P |
| Molecular Weight | 315.26000 |
| Flash Point | 230.7ºC |
| Exact Mass | 315.06600 |
| PSA | 73.49000 |
| LogP | 2.42800 |
| Index of Refraction | 1.62 |
| InChIKey | BXRYKYGZAYPUIK-UHFFFAOYSA-N |
| SMILES | COP(=O)(CN1C(=O)c2ccccc2C1=O)c1ccccc1 |
|
~75%
2-[(methoxy-phe... CAS#:4771-84-0 |
| Literature: Durst; Rohrbaugh; Munavalli Phosphorus, Sulfur and Silicon and the Related Elements, 2009 , vol. 184, # 11 p. 2902 - 2909 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| phenyl-phthalimidomethyl-phosphinic acid methyl ester |
| Methoxy-phthalimidomethyl-phenyl-phosphinoxid |