cyclohexylmethanol,sulfuric acid
Modify Date: 2025-11-06 12:21:12
cyclohexylmethanol,sulfuric acid structure
|
Common Name | cyclohexylmethanol,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 474801-19-9 | Molecular Weight | 326.44900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H30O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclohexylmethanol,sulfuric acid |
|---|
| Molecular Formula | C14H30O6S |
|---|---|
| Molecular Weight | 326.44900 |
| Exact Mass | 326.17600 |
| PSA | 123.44000 |
| LogP | 3.54600 |
| InChIKey | DNJORSZQDNDXFO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)O.OCC1CCCCC1.OCC1CCCCC1 |
|
~%
cyclohexylmetha... CAS#:474801-19-9 |
| Literature: Honda, Takeshi; Masuda, Takeshi; Yoshida, Shuku; Arai, Masami; Kaneko, Satoru; Yamashita, Makoto Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 15 p. 1925 - 1928 |
|
~%
cyclohexylmetha... CAS#:474801-19-9 |
| Literature: Honda, Takeshi; Masuda, Takeshi; Yoshida, Shuku; Arai, Masami; Kaneko, Satoru; Yamashita, Makoto Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 15 p. 1925 - 1928 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |