4-(2-oxo-1,3,3a,4,5,6,7,7a-octahydrobenzoimidazol-5-yl)butanoic acid structure
|
Common Name | 4-(2-oxo-1,3,3a,4,5,6,7,7a-octahydrobenzoimidazol-5-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4746-69-4 | Molecular Weight | 226.27200 | |
| Density | 1.163g/cm3 | Boiling Point | 516.6ºC at 760 mmHg | |
| Molecular Formula | C11H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.2ºC | |
| Name | 4-(2-oxo-1,3,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 516.6ºC at 760 mmHg |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.27200 |
| Flash Point | 266.2ºC |
| Exact Mass | 226.13200 |
| PSA | 78.43000 |
| LogP | 1.74900 |
| Index of Refraction | 1.501 |
| InChIKey | LRUOIOPHUZRRFN-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCC1CCC2NC(=O)NC2C1 |
|
~%
4-(2-oxo-1,3,3a... CAS#:4746-69-4 |
| Literature: English et al. Journal of the American Chemical Society, 1945 , vol. 67, p. 295,301, 2265 |
|
~%
4-(2-oxo-1,3,3a... CAS#:4746-69-4 |
| Literature: English et al. Journal of the American Chemical Society, 1945 , vol. 67, p. 295,301, 2265 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(2-Oxo-octahydro-benzimidazol-5-yl)-buttersaeure |
| 4-(2-oxo-octahydro-benzimidazol-5-yl)-butyric acid |
| 4-(2-oxooctahydro-1h-benzimidazol-5-yl)butanoic acid |