CAL-130 (Racemate)
Modify Date: 2025-08-25 11:21:11
CAL-130 (Racemate) structure
|
Common Name | CAL-130 (Racemate) | ||
|---|---|---|---|---|
| CAS Number | 474012-90-3 | Molecular Weight | 426.47400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22N8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CAL-130 (Racemate)CAL-130 Racemate is the racemate of CAL-130. CAL-130 Racemate is a PI3Kδ inhibitor. |
| Name | 2-[1-[(2-amino-7H-purin-6-yl)amino]ethyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | CAL-130 Racemate is the racemate of CAL-130. CAL-130 Racemate is a PI3Kδ inhibitor. |
|---|---|
| Related Catalog | |
| Target |
PI3Kδ |
| In Vitro | CAL-130 Racemate (Compound D-081a) is a human phosphatidylinositol 3-kinase delta (PI3Kδ)[1]. |
| References |
[1]. Sadhu, Chanchal, et al. Inhibitors of human phosphatidylinositol 3-kinase delta. US 20020161014 A1. |
| Molecular Formula | C23H22N8O |
|---|---|
| Molecular Weight | 426.47400 |
| Exact Mass | 426.19200 |
| PSA | 131.36000 |
| LogP | 2.77610 |
| InChIKey | PUYVJBBSBPUKBT-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-n1c(C(C)Nc2nc(N)nc3nc[nH]c23)nc2cccc(C)c2c1=O |
| Storage condition | 2-8℃ |
| CAL-130 Racemate |
| CS-1220 |
| CAL-130 Racemate||CAL 130 (Racemate) |
| CAL-130 (Racemate) |