2-Chloro-1,3-dicyclopropylpropane-1,3-dione structure
|
Common Name | 2-Chloro-1,3-dicyclopropylpropane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 473924-29-7 | Molecular Weight | 186.63500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Chloro-1,3-dicyclopropylpropane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11ClO2 |
|---|---|
| Molecular Weight | 186.63500 |
| Exact Mass | 186.04500 |
| PSA | 34.14000 |
| LogP | 1.55200 |
| InChIKey | XKTWRKULUNAHBV-UHFFFAOYSA-N |
| SMILES | O=C(C1CC1)C(Cl)C(=O)C1CC1 |
| HS Code | 2914700090 |
|---|
|
~91%
2-Chloro-1,3-di... CAS#:473924-29-7 |
| Literature: Gibson, Karl Richard; Skerratt, Sarah Elizabeth; Dack, Kevin Neil Patent: US2008/96950 A1, 2008 ; Location in patent: Page/Page column 17 ; US 20080096950 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Chloro-1,3-dicyclopropyl-1,3-propanedione |
| 1,3-PROPANEDIONE,2-CHLORO-1,3-DICYCLOPROPYL |