Nitrosulfathiazole
Modify Date: 2025-09-14 00:06:39
Nitrosulfathiazole structure
|
Common Name | Nitrosulfathiazole | ||
|---|---|---|---|---|
| CAS Number | 473-42-7 | Molecular Weight | 285.30000 | |
| Density | 1.648g/cm3 | Boiling Point | 495ºC at 760mmHg | |
| Molecular Formula | C9H7N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2ºC | |
| Name | 4-nitro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.648g/cm3 |
|---|---|
| Boiling Point | 495ºC at 760mmHg |
| Molecular Formula | C9H7N3O4S2 |
| Molecular Weight | 285.30000 |
| Flash Point | 253.2ºC |
| Exact Mass | 284.98800 |
| PSA | 141.50000 |
| LogP | 3.52910 |
| Vapour Pressure | 6.11E-10mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | CIASIHHEOGXVOM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
|
~87%
Nitrosulfathiazole CAS#:473-42-7 |
| Literature: Auxiliadora Dea-Ayuela; Castillo, Encarna; Gonzalez-Alvarez, Marta; Vega, Celeste; Rolon, Miriam; Bolas-Fernandez, Francisco; Borras, Joaquin; Eugenia Gonzalez-Rosende Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 21 p. 7449 - 7456 |
|
~%
Nitrosulfathiazole CAS#:473-42-7 |
| Literature: Morren; Lehmann Journal de Pharmacie de Belgique, 1942 , vol. 1, p. 127 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:72-14-0| 4-Nitro-benzolsulfonsaeure-thiazol-2-ylamid |
| p-nitrosulfathiazole |
| 4-nitro-benzenesulfonic acid thiazol-2-ylamide |
| Nitrosulfatiazol |
| Nisulfazole |
| p-Nitro-N-2-thiazolylbenzenesulfonamide |
| Nitrosulfathiazole |
| para-Nitrosulfathiazole |
| Nisulfazol |
| 4-nitro-N-thiazol-2-yl-benzenesulfonamide |
| 2-(4-nitrophenylsulfonamido)thiazole |