WAY-312666
Modify Date: 2025-07-19 11:08:14
WAY-312666 structure
|
Common Name | WAY-312666 | ||
|---|---|---|---|---|
| CAS Number | 472980-46-4 | Molecular Weight | 442.31628 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 739.8±70.0 °C at 760 mmHg | |
| Molecular Formula | C18H17Cl2N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 401.2±35.7 °C | |
Use of WAY-312666SIRT3 inhibitor scaffolds |
| Name | WAY-312666 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 739.8±70.0 °C at 760 mmHg |
| Molecular Formula | C18H17Cl2N3O4S |
| Molecular Weight | 442.31628 |
| Flash Point | 401.2±35.7 °C |
| Exact Mass | 441.031677 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | GYHVQHACHWPNAF-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(CCNC2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| 4-(2-{[1-(3,4-Dichlorophenyl)-2,5-dioxo-3-pyrrolidinyl]amino}ethyl)benzenesulfonamide |
| 4-(2-{[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]amino}ethyl)benzenesulfonamide |
| Benzenesulfonamide, 4-[2-[[1-(3,4-dichlorophenyl)-2,5-dioxo-3-pyrrolidinyl]amino]ethyl]- |