Methyl 2-(2,2-Dimethylpropanoylamino)Pyridine-4-Carboxylate
Modify Date: 2025-08-26 20:11:29
Methyl 2-(2,2-Dimethylpropanoylamino)Pyridine-4-Carboxylate structure
|
Common Name | Methyl 2-(2,2-Dimethylpropanoylamino)Pyridine-4-Carboxylate | ||
|---|---|---|---|---|
| CAS Number | 470463-38-8 | Molecular Weight | 236.26700 | |
| Density | 1.162 g/cm3 | Boiling Point | 412.7ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O3 | Melting Point | 75.1-75.2ºC | |
| MSDS | N/A | Flash Point | 203.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(2,2-Dimethyl-propionylamino)-isonicotinic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162 g/cm3 |
|---|---|
| Boiling Point | 412.7ºC at 760 mmHg |
| Melting Point | 75.1-75.2ºC |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.26700 |
| Flash Point | 203.4ºC |
| Exact Mass | 236.11600 |
| PSA | 68.29000 |
| LogP | 1.92580 |
| Index of Refraction | 1.545 |
| InChIKey | VIINVAGIQKVNOV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccnc(NC(=O)C(C)(C)C)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylate |