2-(2,2-Dimethyl-propionylamino)-isonicotinic acid structure
|
Common Name | 2-(2,2-Dimethyl-propionylamino)-isonicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 470463-34-4 | Molecular Weight | 222.24000 | |
| Density | 1.249g/cm3 | Boiling Point | 532.5ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | 268.0-268.1ºC | |
| MSDS | USA | Flash Point | 275.8ºC | |
| Name | 2-(2,2-Dimethyl-propionylamino)-isonicotinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 532.5ºC at 760 mmHg |
| Melting Point | 268.0-268.1ºC |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 275.8ºC |
| Exact Mass | 222.10000 |
| PSA | 79.29000 |
| LogP | 1.83740 |
| Index of Refraction | 1.582 |
| InChIKey | LZNLPRWDHJXBEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1cc(C(=O)O)ccn1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2,2-dimethylpropanoylamino)pyridine-4-carboxylic acid |