(3-BROMOPHENYL)(4-FLUOROPHENYL)METHANONE structure
|
Common Name | (3-BROMOPHENYL)(4-FLUOROPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 46698-24-2 | Molecular Weight | 279.10400 | |
| Density | 1.485g/cm3 | Boiling Point | 362ºC at 760mmHg | |
| Molecular Formula | C13H8BrFO | Melting Point | 82-86ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.7ºC | |
| Name | (3-bromophenyl)-(4-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 362ºC at 760mmHg |
| Melting Point | 82-86ºC(lit.) |
| Molecular Formula | C13H8BrFO |
| Molecular Weight | 279.10400 |
| Flash Point | 172.7ºC |
| Exact Mass | 277.97400 |
| PSA | 17.07000 |
| LogP | 3.81920 |
| Index of Refraction | 1.593 |
| InChIKey | QLWGPEHYNFONNA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1cccc(Br)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| p-Fluor-m'-brombenzophenon |
| m-Brom-p'-fluorbenzophenon |
| 3-bromo-4'-fluorobenzophenone |
| MFCD00672034 |