2-Nitratoethanolamine nitrate
Modify Date: 2025-08-24 11:30:31
2-Nitratoethanolamine nitrate structure
|
Common Name | 2-Nitratoethanolamine nitrate | ||
|---|---|---|---|---|
| CAS Number | 4665-58-1 | Molecular Weight | 169.09300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2H7N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Nitratoethanolamine nitrate |
|---|
| Molecular Formula | C2H7N3O6 |
|---|---|
| Molecular Weight | 169.09300 |
| Exact Mass | 169.03300 |
| PSA | 147.12000 |
| LogP | 0.55240 |
| InChIKey | HEIWCRRLFLDZIT-UHFFFAOYSA-N |
| SMILES | NCCO[N+](=O)[O-].O=[N+]([O-])O |
| HS Code | 2922199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:497-25-6
CAS#:65141-46-0| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |