dinonyl benzene-1,4-dicarboxylate
Modify Date: 2025-09-20 22:19:29
dinonyl benzene-1,4-dicarboxylate structure
|
Common Name | dinonyl benzene-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 4654-27-7 | Molecular Weight | 418.60900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H42O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dinonyl benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H42O4 |
|---|---|
| Molecular Weight | 418.60900 |
| Exact Mass | 418.30800 |
| PSA | 52.60000 |
| LogP | 7.50140 |
| InChIKey | UBXIPPSTBVKKIK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)c1ccc(C(=O)OCCCCCCCCC)cc1 |
| HS Code | 2917399090 |
|---|
|
~%
dinonyl benzene... CAS#:4654-27-7 |
| Literature: Miller et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4214 |
|
~%
dinonyl benzene... CAS#:4654-27-7 |
| Literature: Arbusow; Waleewa Zhurnal Fizicheskoi Khimii, 1953 , vol. 27, p. 713,716 Chem.Abstr., 1954 , p. 13 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| terephthalic acid dinonyl ester |
| Di-n-nonylphthalat |
| Terephthalsaeure-dinonylester |
| 1,4-Benzenedicarboxylic acid,dinonyl ester |