bis(tributylstannyl) butanedioate
Modify Date: 2025-08-25 18:38:59
bis(tributylstannyl) butanedioate structure
|
Common Name | bis(tributylstannyl) butanedioate | ||
|---|---|---|---|---|
| CAS Number | 4644-96-6 | Molecular Weight | 696.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H58O4Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(tributylstannyl) butanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H58O4Sn2 |
|---|---|
| Molecular Weight | 696.16000 |
| Exact Mass | 698.23800 |
| PSA | 80.26000 |
| LogP | 6.22840 |
| InChIKey | HXVPZBIFJXDHHK-UHFFFAOYSA-L |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC(=O)CCC(=O)O[Sn](CCCC)(CCCC)CCCC |
| HS Code | 2917190090 |
|---|
|
~99%
bis(tributylsta... CAS#:4644-96-6 |
| Literature: Berlin; Levina; Tiger; Entelis Journal of molecular catalysis, 1991 , vol. 64, # 1 p. 15 - 22 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1461-25-2| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6,11-Dioxa-5,12-distannahexadecane,5,5,12,12-tetrabutyl-7,10-dioxo |