4-bromo-3,5-dihydroxy-N-(2-hydroxyethyl)benzamide structure
|
Common Name | 4-bromo-3,5-dihydroxy-N-(2-hydroxyethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 46427-20-7 | Molecular Weight | 276.08400 | |
| Density | 1.76g/cm3 | Boiling Point | 394.8ºC at 760mmHg | |
| Molecular Formula | C9H10BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.6ºC | |
| Name | 4-bromo-3,5-dihydroxy-N-(2-hydroxyethyl)benzamide |
|---|
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 394.8ºC at 760mmHg |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.08400 |
| Flash Point | 192.6ºC |
| Exact Mass | 274.97900 |
| PSA | 93.28000 |
| LogP | 1.15720 |
| Index of Refraction | 1.654 |
| InChIKey | HLMLWNJLJRZNGJ-UHFFFAOYSA-N |
| SMILES | O=C(NCCO)c1cc(O)c(Br)c(O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |