(R)-2-BROMOBUTANOICACID
Modify Date: 2025-09-15 20:02:00
(R)-2-BROMOBUTANOICACID structure
|
Common Name | (R)-2-BROMOBUTANOICACID | ||
|---|---|---|---|---|
| CAS Number | 4623-25-0 | Molecular Weight | 263.04500 | |
| Density | 1.913g/cm3 | Boiling Point | 310.5ºC at 760 mmHg | |
| Molecular Formula | C7H7BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.6ºC | |
| Name | 5-bromo-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.913g/cm3 |
|---|---|
| Boiling Point | 310.5ºC at 760 mmHg |
| Molecular Formula | C7H7BrN2O4 |
| Molecular Weight | 263.04500 |
| Flash Point | 141.6ºC |
| Exact Mass | 261.95900 |
| PSA | 81.30000 |
| Index of Refraction | 1.627 |
| InChIKey | YLHNSMAGWZXPOQ-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)O)c(Br)c(=O)n(C)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dimethyl-5-bromorotsaeure |
| 5-bromo-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-pyrimidine-4-carboxylic acid |
| 1,3-Dimethyl-5-bromoorotic acid |