potassium,2,3,4,5,6-pentafluorophenolate structure
|
Common Name | potassium,2,3,4,5,6-pentafluorophenolate | ||
|---|---|---|---|---|
| CAS Number | 4615-85-4 | Molecular Weight | 222.15400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F5KO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | potassium,2,3,4,5,6-pentafluorophenolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6F5KO |
|---|---|
| Molecular Weight | 222.15400 |
| Exact Mass | 221.95100 |
| PSA | 23.06000 |
| LogP | 2.52590 |
| InChIKey | OMOSXHQDCWPOKM-UHFFFAOYSA-M |
| SMILES | [K+].[O-]c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2908199090 |
|---|
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Phenol,pentafluoro-,potassium salt |
| Potassium pentafluorophenolate |