2(1H)-Pyrimidinone,4-methoxy-1-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)- structure
|
Common Name | 2(1H)-Pyrimidinone,4-methoxy-1-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)- | ||
|---|---|---|---|---|
| CAS Number | 4603-96-7 | Molecular Weight | 456.40100 | |
| Density | 1.43g/cm3 | Boiling Point | 520.1ºC at 760mmHg | |
| Molecular Formula | C19H24N2O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.4ºC | |
| Name | [3,4,5-triacetyloxy-6-(4-methoxy-2-oxopyrimidin-1-yl)oxan-2-yl]methyl acetate |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 520.1ºC at 760mmHg |
| Molecular Formula | C19H24N2O11 |
| Molecular Weight | 456.40100 |
| Flash Point | 268.4ºC |
| Exact Mass | 456.13800 |
| PSA | 158.55000 |
| Index of Refraction | 1.566 |
| InChIKey | XXYFXHPNMXEYSH-UHFFFAOYSA-N |
| SMILES | COc1ccn(C2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O)c(=O)n1 |
|
~%
2(1H)-Pyrimidin... CAS#:4603-96-7 |
| Literature: Hilbert; Johnson Journal of the American Chemical Society, 1930 , vol. 52, p. 4489,4493 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |