2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-(2-hydroxyethyl)amino]ethanol structure
|
Common Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-(2-hydroxyethyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 4594-76-7 | Molecular Weight | 351.87100 | |
| Density | 1.243g/cm3 | Boiling Point | 565.3ºC at 760 mmHg | |
| Molecular Formula | C18H26ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.7ºC | |
| Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-(2-hydroxyethyl)amino]ethanol |
|---|
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 565.3ºC at 760 mmHg |
| Molecular Formula | C18H26ClN3O2 |
| Molecular Weight | 351.87100 |
| Flash Point | 295.7ºC |
| Exact Mass | 351.17100 |
| PSA | 68.62000 |
| LogP | 2.82840 |
| Index of Refraction | 1.628 |
| InChIKey | BNKWSWSFHIYYKQ-UHFFFAOYSA-N |
| SMILES | CC(CCCN(CCO)CCO)Nc1ccnc2cc(Cl)ccc12 |
| HS Code | 2933990090 |
|---|
|
~%
2-[4-[(7-chloro... CAS#:4594-76-7 |
| Literature: Jones et al. Journal of Organic Chemistry, 1957 , vol. 22, p. 783,785 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |