1-Boc-5-Bromo-3-iodo-1H-indazole structure
|
Common Name | 1-Boc-5-Bromo-3-iodo-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 459133-68-7 | Molecular Weight | 423.04400 | |
| Density | 1.914g/cm3 | Boiling Point | 443.872ºC at 760 mmHg | |
| Molecular Formula | C12H12BrIN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.246ºC | |
| Name | 1-Boc-5-Bromo-3-iodo-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.914g/cm3 |
|---|---|
| Boiling Point | 443.872ºC at 760 mmHg |
| Molecular Formula | C12H12BrIN2O2 |
| Molecular Weight | 423.04400 |
| Flash Point | 222.246ºC |
| Exact Mass | 421.91300 |
| PSA | 44.12000 |
| LogP | 4.18660 |
| Index of Refraction | 1.666 |
| InChIKey | RUXGCTDRNQBDSV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1nc(I)c2cc(Br)ccc21 |
|
~80%
1-Boc-5-Bromo-3... CAS#:459133-68-7 |
| Literature: MERCK SHARP and DOHME CORP.; MCCOMAS, Casey Cameron; LIVERTON, Nigel J.; HABERMANN, Joerg; KOCH, Uwe; NARJES, Frank; LI, Peng; PENG, Xuanjia; SOLL, Richard; WU, Hao; PALANI, Anandan; DAI, Xing; LIU, Hong; HE, Shuwen; DANG, Qung Patent: WO2013/34048 A1, 2013 ; Location in patent: Page/Page column 58 ; |
|
~%
1-Boc-5-Bromo-3... CAS#:459133-68-7 |
| Literature: ABBOTT LABORATORIES Patent: WO2008/154241 A1, 2008 ; Location in patent: Page/Page column 75 ; |
|
~%
1-Boc-5-Bromo-3... CAS#:459133-68-7 |
| Literature: Arnautu, Anca; Collot, Valerie; Ros, Javier Calvo; Alayrac, Carole; Witulski, Bernhard; Rault, Sylvain Tetrahedron Letters, 2002 , vol. 43, # 15 p. 2695 - 2697 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| tert-butyl 5-bromo-3-iodoindazole-1-carboxylate |