Guanidine,N-nitro-N'-(2,2,2-trifluoroethyl)- structure
|
Common Name | Guanidine,N-nitro-N'-(2,2,2-trifluoroethyl)- | ||
|---|---|---|---|---|
| CAS Number | 459-79-0 | Molecular Weight | 186.09300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H5F3N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3H5F3N4O2 |
|---|---|
| Molecular Weight | 186.09300 |
| Exact Mass | 186.03600 |
| PSA | 96.23000 |
| LogP | 1.25910 |
| InChIKey | WOFHDTDNHHCURG-UHFFFAOYSA-N |
| SMILES | NC(=NCC(F)(F)F)N[N+](=O)[O-] |
|
~%
Guanidine,N-nit... CAS#:459-79-0 |
| Literature: Milani et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 2903 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-nitro-N'-(2,2,2-trifluoro-ethyl)-guanidine |
| N-Nitro-N'-(2,2,2-trifluor-aethyl)-guanidin |
| 3-Nitro-1-<2,2,2-trifluor-ethyl>-guanidin |