methyl 4-amino-5-chloro-2-methoxy-3-nitrobenzoate structure
|
Common Name | methyl 4-amino-5-chloro-2-methoxy-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 457947-61-4 | Molecular Weight | 260.63100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-amino-5-chloro-2-methoxy-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9ClN2O5 |
|---|---|
| Molecular Weight | 260.63100 |
| Exact Mass | 260.02000 |
| PSA | 107.37000 |
| LogP | 2.73000 |
| InChIKey | IHQKJDKMQBJBML-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)c(N)c([N+](=O)[O-])c1OC |
|
~99%
methyl 4-amino-... CAS#:457947-61-4 |
| Literature: InterMune, Inc. Patent: US2011/152246 A1, 2011 ; Location in patent: Page/Page column 193 ; |
|
~%
methyl 4-amino-... CAS#:457947-61-4 |
| Literature: Renneberg, Dorte; Dervan, Peter B. Journal of the American Chemical Society, 2003 , vol. 125, # 19 p. 5707 - 5716 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-amino-5-chloro-2-methoxy-3-nitrobenzoic acid methyl ester |
| Benzoic acid,4-amino-5-chloro-2-methoxy-3-nitro-,methyl ester |