(2-benzylidene-3-oxo-benzofuran-6-yl) acetate
Modify Date: 2025-09-20 18:09:40
(2-benzylidene-3-oxo-benzofuran-6-yl) acetate structure
|
Common Name | (2-benzylidene-3-oxo-benzofuran-6-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 4576-37-8 | Molecular Weight | 297.74100 | |
| Density | 1.325g/cm3 | Boiling Point | 465ºC at 760 mmHg | |
| Molecular Formula | C12H16ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.5ºC | |
| Name | 3-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1(2H)-yl)benzoic acid hydrochloride |
|---|
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 465ºC at 760 mmHg |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.74100 |
| Flash Point | 208.5ºC |
| Exact Mass | 297.09900 |
| PSA | 117.30000 |
| LogP | 1.70910 |
| Index of Refraction | 1.654 |
| InChIKey | NTXUKKOGKLAANO-UHFFFAOYSA-N |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1cccc(C(=O)O)c1.Cl |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |