2-[3-(3-hydroxyphenyl)-2,3-dimethylpiperidin-1-yl]-1-phenylethanone
Modify Date: 2025-08-26 12:36:17
![2-[3-(3-hydroxyphenyl)-2,3-dimethylpiperidin-1-yl]-1-phenylethanone Structure](https://image.chemsrc.com/caspic/084/4575-34-2.png)
2-[3-(3-hydroxyphenyl)-2,3-dimethylpiperidin-1-yl]-1-phenylethanone structure
|
Common Name | 2-[3-(3-hydroxyphenyl)-2,3-dimethylpiperidin-1-yl]-1-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 4575-34-2 | Molecular Weight | 323.42900 | |
| Density | 1.094 g/cm3 | Boiling Point | 485.9ºC at 760mmHg | |
| Molecular Formula | C21H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 2-[3-(3-hydroxyphenyl)-2,3-dimethylpiperidin-1-yl]-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.094 g/cm3 |
|---|---|
| Boiling Point | 485.9ºC at 760mmHg |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.42900 |
| Flash Point | 247.7ºC |
| Exact Mass | 323.18900 |
| PSA | 40.54000 |
| LogP | 3.95500 |
| Index of Refraction | 1.567 |
| InChIKey | XMSWGYQEWPUOKA-UHFFFAOYSA-N |
| SMILES | CC1N(CC(=O)c2ccccc2)CCCC1(C)c1cccc(O)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Myfadol |
| Myfadolum [INN-Latin] |
| Mifadol |
| Mifadol [INN-Spanish] |
| TA 306 |
| Myfadol [INN] |
| Myfadolum |