butyl 2-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)acetate
Modify Date: 2025-08-25 14:42:23
butyl 2-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)acetate structure
|
Common Name | butyl 2-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 4567-27-5 | Molecular Weight | 289.32600 | |
| Density | 1.219g/cm3 | Boiling Point | 412.7ºC at 760 mmHg | |
| Molecular Formula | C16H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4ºC | |
| Name | butyl 2-(4-hydroxy-1-methyl-2-oxoquinolin-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 412.7ºC at 760 mmHg |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.32600 |
| Flash Point | 203.4ºC |
| Exact Mass | 289.13100 |
| PSA | 68.53000 |
| LogP | 2.12990 |
| Index of Refraction | 1.568 |
| InChIKey | JXGYUVMELCRZSF-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)Cc1c(O)c2ccccc2n(C)c1=O |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Diethyl-p-tolyl-furfuryl-ammonium-iodid |