6-ethyl-7-methoxy-3-(4-methoxyphenyl)-2-methylchromen-4-one
Modify Date: 2024-09-07 20:32:07
6-ethyl-7-methoxy-3-(4-methoxyphenyl)-2-methylchromen-4-one structure
|
Common Name | 6-ethyl-7-methoxy-3-(4-methoxyphenyl)-2-methylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 4556-55-2 | Molecular Weight | 324.37000 | |
| Density | 1.166g/cm3 | Boiling Point | 482.9ºC at 760 mmHg | |
| Molecular Formula | C20H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6ºC | |
| Name | 6-ethyl-7-methoxy-3-(4-methoxyphenyl)-2-methylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 482.9ºC at 760 mmHg |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.37000 |
| Flash Point | 212.6ºC |
| Exact Mass | 324.13600 |
| PSA | 48.67000 |
| LogP | 4.34800 |
| Index of Refraction | 1.574 |
| InChIKey | DNMNAKNVAWEJQI-UHFFFAOYSA-N |
| SMILES | CCc1cc2c(=O)c(-c3ccc(OC)cc3)c(C)oc2cc1OC |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| semicarbazono-succinic acid diethyl ester |
| Oxalessigsaeurediaethylester-semicarbazon |
| Semicarbazono-bernsteinsaeure-diaethylester |