Ethyl 2-bromo-4,4,4-trifluoro-3-oxobutanoate
Modify Date: 2025-08-27 20:08:39
Ethyl 2-bromo-4,4,4-trifluoro-3-oxobutanoate structure
|
Common Name | Ethyl 2-bromo-4,4,4-trifluoro-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 4544-43-8 | Molecular Weight | 263.00900 | |
| Density | 1.663 | Boiling Point | 199ºC | |
| Molecular Formula | C6H6BrF3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 74ºC | |
| Name | Ethyl 2-bromo-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.663 |
|---|---|
| Boiling Point | 199ºC |
| Molecular Formula | C6H6BrF3O3 |
| Molecular Weight | 263.00900 |
| Flash Point | 74ºC |
| Exact Mass | 261.94500 |
| PSA | 43.37000 |
| LogP | 1.44440 |
| InChIKey | ZJTZICBXLSNOHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)C(=O)C(F)(F)F |
| HS Code | 2918300090 |
|---|
|
~82%
Ethyl 2-bromo-4... CAS#:4544-43-8 |
| Literature: Alinezhad, Heshmatollah; Tajbakhsh, Mahmood; Tehrani, Shahram Shahriari Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 5 p. 1543 - 1546 |
CAS#:3885-40-3
CAS#:344-72-9
CAS#:137929-14-7
CAS#:431-35-6| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Brom-2-<trifluor-acetyl>-essigsaeure-aethylester |
| Ethyl pound inverted question mark2-Bromo-4,4,4-trifluoro-3-oxobutanoate |
| PC5768 |
| 2-bromo-4,4,4-trifluoro-3-oxo-butyric acid ethyl ester |
| ethyl-2-bromo-4,4,4-trifluoro-3-oxobutanoate |
| Ethyl trifluoroacetylbromoacetate |
| 2-bromo-4,4,4-trifluoro-3-oxo-butanoic acid,ethyl ester |