[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methanol
Modify Date: 2025-10-17 10:20:45
![[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methanol Structure](https://image.chemsrc.com/caspic/451/454170-83-3.png)
[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methanol structure
|
Common Name | [4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 454170-83-3 | Molecular Weight | 298.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methanol |
|---|
| Molecular Formula | C16H14N2O4 |
|---|---|
| Molecular Weight | 298.29300 |
| Exact Mass | 298.09500 |
| PSA | 80.95000 |
| LogP | 2.84140 |
| InChIKey | QQZCPXDGCLXKSD-UHFFFAOYSA-N |
| SMILES | [O-][n+]1onc(-c2ccccc2)c1COc1ccc(CO)cc1 |
|
~%
[4-[(2-oxido-4-... CAS#:454170-83-3 |
| Literature: Zou, Xiao-Qing; Peng, Sheng-Ming; Hu, Chang-Ping; Tan, Li-Feng; Deng, Han-Wu; Li, Yuan-Jian Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 4 p. 1222 - 1226 |
|
~%
[4-[(2-oxido-4-... CAS#:454170-83-3 |
| Literature: Zou, Xiao-Qing; Peng, Sheng-Ming; Hu, Chang-Ping; Tan, Li-Feng; Deng, Han-Wu; Li, Yuan-Jian Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 4 p. 1222 - 1226 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]phenyl]methyl 2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyacetate structure](https://image.chemsrc.com/caspic/361/1235587-46-8.png)
CAS#:1235587-46-8