(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate
Modify Date: 2025-09-11 23:07:28
![(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate Structure](https://image.chemsrc.com/caspic/458/4540-25-4.png)
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate structure
|
Common Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 4540-25-4 | Molecular Weight | 291.34200 | |
| Density | 1.26g/cm3 | Boiling Point | 427.3ºC at 760 mmHg | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.3ºC | |
| Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 4-hydroxy-3-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 427.3ºC at 760 mmHg |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.34200 |
| Flash Point | 212.3ºC |
| Exact Mass | 291.14700 |
| PSA | 59.00000 |
| LogP | 2.12070 |
| Index of Refraction | 1.59 |
| InChIKey | OZKTVDIYALBSMA-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)OC2CC3CCC(C2)N3C)ccc1O |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:121-34-6![8-methyl-8-azabicyclo[3.2.1]octan-3-ol structure](https://image.chemsrc.com/caspic/349/7432-10-2.png)
CAS#:7432-10-2| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Fillalbin |
| O-Vanilloyl-tropin |
| concneorine |
| Phyllalbine |
| Prestwick_1029 |