3-nitro-N-phenylaniline structure
|
Common Name | 3-nitro-N-phenylaniline | ||
|---|---|---|---|---|
| CAS Number | 4531-79-7 | Molecular Weight | 214.22000 | |
| Density | 1.28g/cm3 | Boiling Point | 359.3ºC at 760mmHg | |
| Molecular Formula | C12H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
| Name | 3-nitro-N-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 359.3ºC at 760mmHg |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22000 |
| Flash Point | 171.1ºC |
| Exact Mass | 214.07400 |
| PSA | 57.85000 |
| LogP | 3.93460 |
| Index of Refraction | 1.665 |
| InChIKey | VNRHTFXMONFRSL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Nc2ccccc2)c1 |
| HS Code | 2921440000 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diphenylamine,3-nitro |
| 3-Nitrodiphenylamine |