6-(2-ethyl-5-nitro-3-propyl-imidazol-4-yl)sulfanyl-5H-purine
Modify Date: 2025-08-25 17:54:01
6-(2-ethyl-5-nitro-3-propyl-imidazol-4-yl)sulfanyl-5H-purine structure
|
Common Name | 6-(2-ethyl-5-nitro-3-propyl-imidazol-4-yl)sulfanyl-5H-purine | ||
|---|---|---|---|---|
| CAS Number | 4526-64-1 | Molecular Weight | 333.36900 | |
| Density | 1.59g/cm3 | Boiling Point | 551.7ºC at 760 mmHg | |
| Molecular Formula | C13H15N7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | 6-(2-ethyl-5-nitro-3-propylimidazol-4-yl)sulfanyl-7H-purine |
|---|
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 551.7ºC at 760 mmHg |
| Molecular Formula | C13H15N7O2S |
| Molecular Weight | 333.36900 |
| Flash Point | 287.4ºC |
| Exact Mass | 333.10100 |
| PSA | 143.40000 |
| LogP | 3.10440 |
| Index of Refraction | 1.774 |
| InChIKey | UXOPOAKIXAXPKT-UHFFFAOYSA-N |
| SMILES | CCCn1c(CC)nc([N+](=O)[O-])c1Sc1ncnc2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |