tris(hex-1-ynyl)alumane structure
|
Common Name | tris(hex-1-ynyl)alumane | ||
|---|---|---|---|---|
| CAS Number | 45234-85-3 | Molecular Weight | 270.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27Al | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tris(hex-1-ynyl)alumane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H27Al |
|---|---|
| Molecular Weight | 270.38900 |
| Exact Mass | 270.19300 |
| LogP | 5.06040 |
| InChIKey | NLSTYIJHXPUEKV-UHFFFAOYSA-N |
| SMILES | CCCCC#C[Al](C#CCCCC)C#CCCCC |
|
~%
tris(hex-1-ynyl... CAS#:45234-85-3 |
| Literature: Ley, Steven V.; Burckhardt, Svenja; Cox, Liam R.; Meek, Graham Journal of the Chemical Society - Perkin Transactions 1, 1997 , # 22 p. 3327 - 3337 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Tris-<hexin-1-yl>-aluminium |
| Aluminum,tri-1-hexynyl |
| Tris-butylaethinyl-aluminium |