2-chloro-3,5-dinitrobenzenesulphonic acid structure
|
Common Name | 2-chloro-3,5-dinitrobenzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 4515-26-8 | Molecular Weight | 282.61500 | |
| Density | 1.911 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H3ClN2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-3,5-dinitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.911 g/cm3 |
|---|---|
| Molecular Formula | C6H3ClN2O7S |
| Molecular Weight | 282.61500 |
| Exact Mass | 281.93500 |
| PSA | 154.39000 |
| LogP | 3.53030 |
| Index of Refraction | 1.651 |
| InChIKey | ODEUZCDONYETMV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c(S(=O)(=O)O)c1 |
| HS Code | 2904909090 |
|---|
|
~%
2-chloro-3,5-di... CAS#:4515-26-8 |
| Literature: Karpuchin Chem. Zentralbl., 1929 , vol. 100, # I p. 3091 |
|
~%
2-chloro-3,5-di... CAS#:4515-26-8 |
| Literature: Pollitt,R.J. Journal of the Chemical Society, 1965 , p. 6198 - 6201 |
|
~%
2-chloro-3,5-di... CAS#:4515-26-8 |
| Literature: Ges.f.chem.Ind. Patent: DE116339 ; Full Text Show Details Ullmann; Herre Justus Liebigs Annalen der Chemie, 1909 , vol. 366, p. 112 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Chlor-3,5-dinitro-benzol-1-sulfonsaeure |
| EINECS 224-839-9 |
| 2,4-DIBROMO-3-AMINOPYRIDINE |
| 2,4-DINITROCHLOROBENZENE-6-SULFONIC ACID |
| 2-Chloro-3,5-dinitrobenzenesulphonic acid |
| 2-Chlor-3.5-dinitro-benzol-sulfonsaeure |
| 2-Chlor-3.5-dinitro-phenyl-sulfonsaeure |
| 2-chloro-3,5-dinitro-benzenesulfonic acid |